C21H23ClN4O2 — CID 134312620
7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-1-methylpyrrolo[3,2-b]pyridine-5-carboxamide (PubChem CID 134312620) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-1-methylpyrrolo[3,2-b]pyridine-5-carboxamide.
| Compound Name | 7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-1-methylpyrrolo[3,2-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 134312620 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 7-[(6-chloro-3-pyridinyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-1-methylpyrrolo[3,2-b]pyridine-5-carboxamide |
| SMILES | Cn1ccc2nc(C(=O)N[C@H]3CCCC[C@@H]3O)cc(Cc3ccc(Cl)nc3)c21 |
| InChI | InChI=1S/C21H23ClN4O2/c1-26-9-8-16-20(26)14(10-13-6-7-19(22)23-12-13)11-17(24-16)21(28)25-15-4-2-3-5-18(15)27/h6-9,11-12,15,18,27H,2-5,10H2,1H3,(H,25,28)/t15-,18-/m0/s1 |
| InChIKey | HWJYBQQYEOLHOU-YJBOKZPZSA-N |
| XLogP | 3.25 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|