C26H28N5O2+ — CID 140706788
N-[(1S,2R)-2-hydroxycyclohexyl]-4-[[6-(1-methyl-3H-pyrazol-1-ium-4-yl)-3-pyridinyl]methyl]quinoline-2-carboxamide (PubChem CID 140706788) has the molecular formula C26H28N5O2+ and a molecular weight of 442.54 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxycyclohexyl]-4-[[6-(1-methyl-3H-pyrazol-1-ium-4-yl)-3-pyridinyl]methyl]quinoline-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-hydroxycyclohexyl]-4-[[6-(1-methyl-3H-pyrazol-1-ium-4-yl)-3-pyridinyl]methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 140706788 |
| Molecular Formula | C26H28N5O2+ |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-[(1S,2R)-2-hydroxycyclohexyl]-4-[[6-(1-methyl-3H-pyrazol-1-ium-4-yl)-3-pyridinyl]methyl]quinoline-2-carboxamide |
| SMILES | C[N+]1=NCC(c2ccc(Cc3cc(C(=O)N[C@H]4CCCC[C@H]4O)nc4ccccc34)cn2)=C1 |
| InChI | InChI=1S/C26H27N5O2/c1-31-16-19(15-28-31)21-11-10-17(14-27-21)12-18-13-24(29-22-7-3-2-6-20(18)22)26(33)30-23-8-4-5-9-25(23)32/h2-3,6-7,10-11,13-14,16,23,25,32H,4-5,8-9,12,15H2,1H3/p+1/t23-,25+/m0/s1 |
| InChIKey | WIBNHTLHHBHFQN-UKILVPOCSA-O |
| XLogP | 3.70 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|