C19H23BrN2O2 — CID 130441265
4-bromo-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide (PubChem CID 130441265) has the molecular formula C19H23BrN2O2 and a molecular weight of 391.31 g/mol. Its IUPAC name is 4-bromo-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 130441265 |
| Molecular Formula | C19H23BrN2O2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-bromo-N-[(2S)-2-hydroxycyclohexyl]-1-(methylaminomethyl)naphthalene-2-carboxamide |
| SMILES | CNCc1c(C(=O)NC2CCCC[C@@H]2O)cc(Br)c2ccccc12 |
| InChI | InChI=1S/C19H23BrN2O2/c1-21-11-15-12-6-2-3-7-13(12)16(20)10-14(15)19(24)22-17-8-4-5-9-18(17)23/h2-3,6-7,10,17-18,21,23H,4-5,8-9,11H2,1H3,(H,22,24)/t17?,18-/m0/s1 |
| InChIKey | AMYIVJMMJZWXQZ-ZVAWYAOSSA-N |
| XLogP | 3.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |