C15H21BrN2O2 — CID 135309339
2-amino-5-bromo-N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dimethylbenzamide (PubChem CID 135309339) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dimethylbenzamide.
| Compound Name | 2-amino-5-bromo-N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 135309339 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-amino-5-bromo-N-[(1R,2R)-2-hydroxycyclohexyl]-3,4-dimethylbenzamide |
| SMILES | Cc1c(Br)cc(C(=O)N[C@@H]2CCCC[C@H]2O)c(N)c1C |
| InChI | InChI=1S/C15H21BrN2O2/c1-8-9(2)14(17)10(7-11(8)16)15(20)18-12-5-3-4-6-13(12)19/h7,12-13,19H,3-6,17H2,1-2H3,(H,18,20)/t12-,13-/m1/s1 |
| InChIKey | XEBBLNJBADXCCY-CHWSQXEVSA-N |
| XLogP | 2.68 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|