C16H20BrN3O2 — CID 90290587
5-amino-8-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydroisoquinoline-6-carboxamide (PubChem CID 90290587) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 5-amino-8-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydroisoquinoline-6-carboxamide.
| Compound Name | 5-amino-8-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 90290587 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 5-amino-8-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydroisoquinoline-6-carboxamide |
| SMILES | Nc1c(C(=O)N[C@H]2CCCC[C@@H]2O)cc(Br)c2c1=CCNC=2 |
| InChI | InChI=1S/C16H20BrN3O2/c17-12-7-10(15(18)9-5-6-19-8-11(9)12)16(22)20-13-3-1-2-4-14(13)21/h5,7-8,13-14,19,21H,1-4,6,18H2,(H,20,22)/t13-,14-/m0/s1 |
| InChIKey | CCDBDHLKZBJKRJ-KBPBESRZSA-N |
| XLogP | 0.19 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|