C19H16ClNO3 — CID 86677537
methyl 4-[(6-chloro-3-pyridinyl)methyl]-1-methoxynaphthalene-2-carboxylate (PubChem CID 86677537) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is methyl 4-[(6-chloro-3-pyridinyl)methyl]-1-methoxynaphthalene-2-carboxylate.
| Compound Name | methyl 4-[(6-chloro-3-pyridinyl)methyl]-1-methoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 86677537 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | methyl 4-[(6-chloro-3-pyridinyl)methyl]-1-methoxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(Cc2ccc(Cl)nc2)c2ccccc2c1OC |
| InChI | InChI=1S/C19H16ClNO3/c1-23-18-15-6-4-3-5-14(15)13(10-16(18)19(22)24-2)9-12-7-8-17(20)21-11-12/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | CWMUQNVXMSUGEA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|