C25H25ClN4O — CID 46208973
6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-(methylamino)cyclohexyl]benzo[h]quinazolin-4-one (PubChem CID 46208973) has the molecular formula C25H25ClN4O and a molecular weight of 432.96 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-(methylamino)cyclohexyl]benzo[h]quinazolin-4-one.
| Compound Name | 6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-(methylamino)cyclohexyl]benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 46208973 |
| Molecular Formula | C25H25ClN4O |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)methyl]-3-[(1S,2S)-2-(methylamino)cyclohexyl]benzo[h]quinazolin-4-one |
| SMILES | CN[C@H]1CCCC[C@@H]1n1cnc2c(cc(Cc3ccc(Cl)nc3)c3ccccc32)c1=O |
| InChI | InChI=1S/C25H25ClN4O/c1-27-21-8-4-5-9-22(21)30-15-29-24-19-7-3-2-6-18(19)17(13-20(24)25(30)31)12-16-10-11-23(26)28-14-16/h2-3,6-7,10-11,13-15,21-22,27H,4-5,8-9,12H2,1H3/t21-,22-/m0/s1 |
| InChIKey | LINHKRKNGGJEHJ-VXKWHMMOSA-N |
| XLogP | 4.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|