C25H25N3O2 — CID 70232676
3-cyclohexyl-6-[(6-methoxy-3-pyridinyl)methyl]benzo[h]quinazolin-4-one (PubChem CID 70232676) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-cyclohexyl-6-[(6-methoxy-3-pyridinyl)methyl]benzo[h]quinazolin-4-one.
| Compound Name | 3-cyclohexyl-6-[(6-methoxy-3-pyridinyl)methyl]benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 70232676 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-cyclohexyl-6-[(6-methoxy-3-pyridinyl)methyl]benzo[h]quinazolin-4-one |
| SMILES | COc1ccc(Cc2cc3c(=O)n(C4CCCCC4)cnc3c3ccccc23)cn1 |
| InChI | InChI=1S/C25H25N3O2/c1-30-23-12-11-17(15-26-23)13-18-14-22-24(21-10-6-5-9-20(18)21)27-16-28(25(22)29)19-7-3-2-4-8-19/h5-6,9-12,14-16,19H,2-4,7-8,13H2,1H3 |
| InChIKey | HWNBLIJNSXHKQZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|