C25H25N3O — CID 157394343
3-[(1S,2S)-2-methylcyclohexyl]-6-(pyridin-3-ylmethyl)benzo[h]quinazolin-4-one (PubChem CID 157394343) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-[(1S,2S)-2-methylcyclohexyl]-6-(pyridin-3-ylmethyl)benzo[h]quinazolin-4-one.
| Compound Name | 3-[(1S,2S)-2-methylcyclohexyl]-6-(pyridin-3-ylmethyl)benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 157394343 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3-[(1S,2S)-2-methylcyclohexyl]-6-(pyridin-3-ylmethyl)benzo[h]quinazolin-4-one |
| SMILES | C[C@H]1CCCC[C@@H]1n1cnc2c(cc(Cc3cccnc3)c3ccccc32)c1=O |
| InChI | InChI=1S/C25H25N3O/c1-17-7-2-5-11-23(17)28-16-27-24-21-10-4-3-9-20(21)19(14-22(24)25(28)29)13-18-8-6-12-26-15-18/h3-4,6,8-10,12,14-17,23H,2,5,7,11,13H2,1H3/t17-,23-/m0/s1 |
| InChIKey | JAZFNFKIIDCKQB-SBUREZEXSA-N |
| XLogP | 5.29 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|