C25H23ClN4O3 — CID 75599129
3-(1-acetyl-3-hydroxypiperidin-4-yl)-6-[(6-chloro-3-pyridinyl)methyl]benzo[h]quinazolin-4-one (PubChem CID 75599129) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is 3-(1-acetyl-3-hydroxypiperidin-4-yl)-6-[(6-chloro-3-pyridinyl)methyl]benzo[h]quinazolin-4-one.
| Compound Name | 3-(1-acetyl-3-hydroxypiperidin-4-yl)-6-[(6-chloro-3-pyridinyl)methyl]benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 75599129 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3-(1-acetyl-3-hydroxypiperidin-4-yl)-6-[(6-chloro-3-pyridinyl)methyl]benzo[h]quinazolin-4-one |
| SMILES | CC(=O)N1CCC(n2cnc3c(cc(Cc4ccc(Cl)nc4)c4ccccc43)c2=O)C(O)C1 |
| InChI | InChI=1S/C25H23ClN4O3/c1-15(31)29-9-8-21(22(32)13-29)30-14-28-24-19-5-3-2-4-18(19)17(11-20(24)25(30)33)10-16-6-7-23(26)27-12-16/h2-7,11-12,14,21-22,32H,8-10,13H2,1H3 |
| InChIKey | PKRIVTPZEFUPFV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|