C24H26ClN3O2 — CID 130407289
6-[(6-chloro-3-pyridinyl)methyl]-3-(2-hydroxycycloheptyl)-8,9-dihydro-7H-cyclopenta[h]quinazolin-4-one (PubChem CID 130407289) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)methyl]-3-(2-hydroxycycloheptyl)-8,9-dihydro-7H-cyclopenta[h]quinazolin-4-one.
| Compound Name | 6-[(6-chloro-3-pyridinyl)methyl]-3-(2-hydroxycycloheptyl)-8,9-dihydro-7H-cyclopenta[h]quinazolin-4-one |
|---|---|
| PubChem CID | 130407289 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)methyl]-3-(2-hydroxycycloheptyl)-8,9-dihydro-7H-cyclopenta[h]quinazolin-4-one |
| SMILES | O=c1c2cc(Cc3ccc(Cl)nc3)c3c(c2ncn1C1CCCCCC1O)CCC3 |
| InChI | InChI=1S/C24H26ClN3O2/c25-22-10-9-15(13-26-22)11-16-12-19-23(18-6-4-5-17(16)18)27-14-28(24(19)30)20-7-2-1-3-8-21(20)29/h9-10,12-14,20-21,29H,1-8,11H2 |
| InChIKey | WLXOVKDEZAEHOW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|