C28H24ClN5O2 — CID 53260435
6-[[4-(2-chloropyrimidin-5-yl)phenyl]methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[3,2-h]quinazolin-4-one (PubChem CID 53260435) has the molecular formula C28H24ClN5O2 and a molecular weight of 497.99 g/mol. Its IUPAC name is 6-[[4-(2-chloropyrimidin-5-yl)phenyl]methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[3,2-h]quinazolin-4-one.
| Compound Name | 6-[[4-(2-chloropyrimidin-5-yl)phenyl]methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[3,2-h]quinazolin-4-one |
|---|---|
| PubChem CID | 53260435 |
| Molecular Formula | C28H24ClN5O2 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 6-[[4-(2-chloropyrimidin-5-yl)phenyl]methyl]-3-[(1S,2S)-2-hydroxycyclohexyl]pyrido[3,2-h]quinazolin-4-one |
| SMILES | O=c1c2cc(Cc3ccc(-c4cnc(Cl)nc4)cc3)c3cccnc3c2ncn1[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C28H24ClN5O2/c29-28-31-14-20(15-32-28)18-9-7-17(8-10-18)12-19-13-22-26(25-21(19)4-3-11-30-25)33-16-34(27(22)36)23-5-1-2-6-24(23)35/h3-4,7-11,13-16,23-24,35H,1-2,5-6,12H2/t23-,24-/m0/s1 |
| InChIKey | FEPMINRNPPAFLO-ZEQRLZLVSA-N |
| XLogP | 5.12 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|