C28H30N4O3 — CID 53261550
3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(4-morpholin-4-ylphenyl)methyl]pyrido[3,4-h]quinazolin-4-one (PubChem CID 53261550) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(4-morpholin-4-ylphenyl)methyl]pyrido[3,4-h]quinazolin-4-one.
| Compound Name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(4-morpholin-4-ylphenyl)methyl]pyrido[3,4-h]quinazolin-4-one |
|---|---|
| PubChem CID | 53261550 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(4-morpholin-4-ylphenyl)methyl]pyrido[3,4-h]quinazolin-4-one |
| SMILES | O=c1c2cc(Cc3ccc(N4CCOCC4)cc3)c3cnccc3c2ncn1[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C28H30N4O3/c33-26-4-2-1-3-25(26)32-18-30-27-22-9-10-29-17-24(22)20(16-23(27)28(32)34)15-19-5-7-21(8-6-19)31-11-13-35-14-12-31/h5-10,16-18,25-26,33H,1-4,11-15H2/t25-,26-/m0/s1 |
| InChIKey | ZLVODOUETZLIOK-UIOOFZCWSA-N |
| XLogP | 3.85 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|