C29H27N5O3 — CID 53259625
3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxypyrazin-2-yl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one (PubChem CID 53259625) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxypyrazin-2-yl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one.
| Compound Name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxypyrazin-2-yl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one |
|---|---|
| PubChem CID | 53259625 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxypyrazin-2-yl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one |
| SMILES | COc1cncc(-c2ccc(Cc3cc4c(=O)n([C@H]5CCCC[C@@H]5O)cnc4c4ncccc34)cc2)n1 |
| InChI | InChI=1S/C29H27N5O3/c1-37-26-16-30-15-23(33-26)19-10-8-18(9-11-19)13-20-14-22-28(27-21(20)5-4-12-31-27)32-17-34(29(22)36)24-6-2-3-7-25(24)35/h4-5,8-12,14-17,24-25,35H,2-3,6-7,13H2,1H3/t24-,25-/m0/s1 |
| InChIKey | ZRIUIUWJSIHYLI-DQEYMECFSA-N |
| XLogP | 4.48 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|