C28H23FN4O3 — CID 53260278
6-[[4-(5-fluoro-3-pyridinyl)phenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]pyrido[3,2-h]quinazolin-4-one (PubChem CID 53260278) has the molecular formula C28H23FN4O3 and a molecular weight of 482.52 g/mol. Its IUPAC name is 6-[[4-(5-fluoro-3-pyridinyl)phenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]pyrido[3,2-h]quinazolin-4-one.
| Compound Name | 6-[[4-(5-fluoro-3-pyridinyl)phenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]pyrido[3,2-h]quinazolin-4-one |
|---|---|
| PubChem CID | 53260278 |
| Molecular Formula | C28H23FN4O3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 6-[[4-(5-fluoro-3-pyridinyl)phenyl]methyl]-3-[(3R,4S)-3-hydroxyoxan-4-yl]pyrido[3,2-h]quinazolin-4-one |
| SMILES | O=c1c2cc(Cc3ccc(-c4cncc(F)c4)cc3)c3cccnc3c2ncn1[C@H]1CCOC[C@@H]1O |
| InChI | InChI=1S/C28H23FN4O3/c29-21-11-20(13-30-14-21)18-5-3-17(4-6-18)10-19-12-23-27(26-22(19)2-1-8-31-26)32-16-33(28(23)35)24-7-9-36-15-25(24)34/h1-6,8,11-14,16,24-25,34H,7,9-10,15H2/t24-,25-/m0/s1 |
| InChIKey | JJPQQPHOSVDIDJ-DQEYMECFSA-N |
| XLogP | 4.06 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|