C30H28N4O3 — CID 53260119
3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxy-3-pyridinyl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one (PubChem CID 53260119) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxy-3-pyridinyl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one.
| Compound Name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxy-3-pyridinyl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one |
|---|---|
| PubChem CID | 53260119 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[[4-(6-methoxy-3-pyridinyl)phenyl]methyl]pyrido[3,2-h]quinazolin-4-one |
| SMILES | COc1ccc(-c2ccc(Cc3cc4c(=O)n([C@H]5CCCC[C@@H]5O)cnc4c4ncccc34)cc2)cn1 |
| InChI | InChI=1S/C30H28N4O3/c1-37-27-13-12-21(17-32-27)20-10-8-19(9-11-20)15-22-16-24-29(28-23(22)5-4-14-31-28)33-18-34(30(24)36)25-6-2-3-7-26(25)35/h4-5,8-14,16-18,25-26,35H,2-3,6-7,15H2,1H3/t25-,26-/m0/s1 |
| InChIKey | HWXHHSVNOYKYBA-UIOOFZCWSA-N |
| XLogP | 5.08 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|