C22H20ClFN2O2 — CID 123348184
4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-(oxan-3-yl)naphthalene-2-carboxamide (PubChem CID 123348184) has the molecular formula C22H20ClFN2O2 and a molecular weight of 398.87 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-(oxan-3-yl)naphthalene-2-carboxamide.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-(oxan-3-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 123348184 |
| Molecular Formula | C22H20ClFN2O2 |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-(oxan-3-yl)naphthalene-2-carboxamide |
| SMILES | O=C(NC1CCCOC1)c1cc(Cc2ccc(Cl)nc2)c2ccccc2c1F |
| InChI | InChI=1S/C22H20ClFN2O2/c23-20-8-7-14(12-25-20)10-15-11-19(21(24)18-6-2-1-5-17(15)18)22(27)26-16-4-3-9-28-13-16/h1-2,5-8,11-12,16H,3-4,9-10,13H2,(H,26,27) |
| InChIKey | IJJORQNJSHIYKK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|