C10H12ClNO3 — CID 130173637
2-chloro-N-(oxan-3-yl)furan-3-carboxamide (PubChem CID 130173637) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 2-chloro-N-(oxan-3-yl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(oxan-3-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 130173637 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-chloro-N-(oxan-3-yl)furan-3-carboxamide |
| SMILES | O=C(NC1CCCOC1)c1ccoc1Cl |
| InChI | InChI=1S/C10H12ClNO3/c11-9-8(3-5-15-9)10(13)12-7-2-1-4-14-6-7/h3,5,7H,1-2,4,6H2,(H,12,13) |
| InChIKey | PTMSAUHKPGQCMO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |