C8H9ClN2O2 — CID 106688544
N-(azetidin-3-yl)-2-chlorofuran-3-carboxamide (PubChem CID 106688544) has the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. Its IUPAC name is N-(azetidin-3-yl)-2-chlorofuran-3-carboxamide.
| Compound Name | N-(azetidin-3-yl)-2-chlorofuran-3-carboxamide |
|---|---|
| PubChem CID | 106688544 |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | N-(azetidin-3-yl)-2-chlorofuran-3-carboxamide |
| SMILES | O=C(NC1CNC1)c1ccoc1Cl |
| InChI | InChI=1S/C8H9ClN2O2/c9-7-6(1-2-13-7)8(12)11-5-3-10-4-5/h1-2,5,10H,3-4H2,(H,11,12) |
| InChIKey | APZAIJPWQHYYNB-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |