C14H15ClN4O2 — CID 46963454
2-chloro-N-(oxan-3-yl)-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 46963454) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-chloro-N-(oxan-3-yl)-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2-chloro-N-(oxan-3-yl)-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 46963454 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-chloro-N-(oxan-3-yl)-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(NC1CCCOC1)c1ccc(-n2cnnc2)cc1Cl |
| InChI | InChI=1S/C14H15ClN4O2/c15-13-6-11(19-8-16-17-9-19)3-4-12(13)14(20)18-10-2-1-5-21-7-10/h3-4,6,8-10H,1-2,5,7H2,(H,18,20) |
| InChIKey | CFOVWONWUBWWDG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |