C13H17NO3 — CID 82829580
3-hydroxy-2-methyl-N-(oxan-3-yl)benzamide (PubChem CID 82829580) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-N-(oxan-3-yl)benzamide.
| Compound Name | 3-hydroxy-2-methyl-N-(oxan-3-yl)benzamide |
|---|---|
| PubChem CID | 82829580 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-hydroxy-2-methyl-N-(oxan-3-yl)benzamide |
| SMILES | Cc1c(O)cccc1C(=O)NC1CCCOC1 |
| InChI | InChI=1S/C13H17NO3/c1-9-11(5-2-6-12(9)15)13(16)14-10-4-3-7-17-8-10/h2,5-6,10,15H,3-4,7-8H2,1H3,(H,14,16) |
| InChIKey | RWQWQMRHUCAVFF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |