C13H17ClN2O4S — CID 107100983
3-chloro-2-methyl-N-(oxan-3-yl)-5-sulfamoylbenzamide (PubChem CID 107100983) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(oxan-3-yl)-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-2-methyl-N-(oxan-3-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 107100983 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-chloro-2-methyl-N-(oxan-3-yl)-5-sulfamoylbenzamide |
| SMILES | Cc1c(Cl)cc(S(N)(=O)=O)cc1C(=O)NC1CCCOC1 |
| InChI | InChI=1S/C13H17ClN2O4S/c1-8-11(5-10(6-12(8)14)21(15,18)19)13(17)16-9-3-2-4-20-7-9/h5-6,9H,2-4,7H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | YFDPBEZPBFGQKW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |