C12H14BrClN2O4S — CID 65388673
5-bromo-2-chloro-N-(oxan-3-yl)-3-sulfamoylbenzamide (PubChem CID 65388673) has the molecular formula C12H14BrClN2O4S and a molecular weight of 397.68 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(oxan-3-yl)-3-sulfamoylbenzamide.
| Compound Name | 5-bromo-2-chloro-N-(oxan-3-yl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65388673 |
| Molecular Formula | C12H14BrClN2O4S |
| Molecular Weight | 397.68 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 5-bromo-2-chloro-N-(oxan-3-yl)-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(Br)cc(C(=O)NC2CCCOC2)c1Cl |
| InChI | InChI=1S/C12H14BrClN2O4S/c13-7-4-9(11(14)10(5-7)21(15,18)19)12(17)16-8-2-1-3-20-6-8/h4-5,8H,1-3,6H2,(H,16,17)(H2,15,18,19) |
| InChIKey | DAOYTQKAWGSPEA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.68 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |