C14H19ClN2O3S — CID 107101066
3-chloro-N-(3-cyclopropylpropyl)-2-methyl-5-sulfamoylbenzamide (PubChem CID 107101066) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 3-chloro-N-(3-cyclopropylpropyl)-2-methyl-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-N-(3-cyclopropylpropyl)-2-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 107101066 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-chloro-N-(3-cyclopropylpropyl)-2-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1c(Cl)cc(S(N)(=O)=O)cc1C(=O)NCCCC1CC1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-9-12(7-11(8-13(9)15)21(16,19)20)14(18)17-6-2-3-10-4-5-10/h7-8,10H,2-6H2,1H3,(H,17,18)(H2,16,19,20) |
| InChIKey | GSTXTAHVPXQVOK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|