C16H19ClN4O — CID 6458239
2-chloro-N-cycloheptyl-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 6458239) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 2-chloro-N-cycloheptyl-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2-chloro-N-cycloheptyl-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 6458239 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-chloro-N-cycloheptyl-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc(-n2cnnc2)cc1Cl |
| InChI | InChI=1S/C16H19ClN4O/c17-15-9-13(21-10-18-19-11-21)7-8-14(15)16(22)20-12-5-3-1-2-4-6-12/h7-12H,1-6H2,(H,20,22) |
| InChIKey | ZKYGMXGRRJVZBZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |