C19H19Cl2NO3 — CID 56558388
2-[(2,4-dichlorophenyl)methoxy]-N-(oxan-3-yl)benzamide (PubChem CID 56558388) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-N-(oxan-3-yl)benzamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-N-(oxan-3-yl)benzamide |
|---|---|
| PubChem CID | 56558388 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-N-(oxan-3-yl)benzamide |
| SMILES | O=C(NC1CCCOC1)c1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO3/c20-14-8-7-13(17(21)10-14)11-25-18-6-2-1-5-16(18)19(23)22-15-4-3-9-24-12-15/h1-2,5-8,10,15H,3-4,9,11-12H2,(H,22,23) |
| InChIKey | VJMHDQVRIRNNMM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |