C20H16Cl2N2O4S — CID 2123312
2-[(2,4-dichlorophenyl)methoxy]-N-(4-sulfamoylphenyl)benzamide (PubChem CID 2123312) has the molecular formula C20H16Cl2N2O4S and a molecular weight of 451.33 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 2123312 |
| Molecular Formula | C20H16Cl2N2O4S |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccccc2OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O4S/c21-14-6-5-13(18(22)11-14)12-28-19-4-2-1-3-17(19)20(25)24-15-7-9-16(10-8-15)29(23,26)27/h1-11H,12H2,(H,24,25)(H2,23,26,27) |
| InChIKey | SXRZVJRICAASBB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |