C17H17Cl2NO3 — CID 78795831
2-[(2,4-dichlorophenyl)methoxy]-N-(3-hydroxypropyl)benzamide (PubChem CID 78795831) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-N-(3-hydroxypropyl)benzamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-N-(3-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 78795831 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-N-(3-hydroxypropyl)benzamide |
| SMILES | O=C(NCCCO)c1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2NO3/c18-13-7-6-12(15(19)10-13)11-23-16-5-2-1-4-14(16)17(22)20-8-3-9-21/h1-2,4-7,10,21H,3,8-9,11H2,(H,20,22) |
| InChIKey | OZJQXLNGIULDIA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|