C24H26ClFN2O — CID 144891463
4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-heptan-2-ylnaphthalene-2-carboxamide (PubChem CID 144891463) has the molecular formula C24H26ClFN2O and a molecular weight of 412.94 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-heptan-2-ylnaphthalene-2-carboxamide.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-heptan-2-ylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 144891463 |
| Molecular Formula | C24H26ClFN2O |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-1-fluoro-N-heptan-2-ylnaphthalene-2-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1cc(Cc2ccc(Cl)nc2)c2ccccc2c1F |
| InChI | InChI=1S/C24H26ClFN2O/c1-3-4-5-8-16(2)28-24(29)21-14-18(13-17-11-12-22(25)27-15-17)19-9-6-7-10-20(19)23(21)26/h6-7,9-12,14-16H,3-5,8,13H2,1-2H3,(H,28,29) |
| InChIKey | ONZCYBXXZAPFOL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|