C21H21ClN2O5 — CID 118468333
methyl 3-chloro-4-methoxy-2-(methoxymethoxy)-5-[(4-pyrazol-1-ylphenyl)methyl]benzoate (PubChem CID 118468333) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is methyl 3-chloro-4-methoxy-2-(methoxymethoxy)-5-[(4-pyrazol-1-ylphenyl)methyl]benzoate.
| Compound Name | methyl 3-chloro-4-methoxy-2-(methoxymethoxy)-5-[(4-pyrazol-1-ylphenyl)methyl]benzoate |
|---|---|
| PubChem CID | 118468333 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | methyl 3-chloro-4-methoxy-2-(methoxymethoxy)-5-[(4-pyrazol-1-ylphenyl)methyl]benzoate |
| SMILES | COCOc1c(C(=O)OC)cc(Cc2ccc(-n3cccn3)cc2)c(OC)c1Cl |
| InChI | InChI=1S/C21H21ClN2O5/c1-26-13-29-20-17(21(25)28-3)12-15(19(27-2)18(20)22)11-14-5-7-16(8-6-14)24-10-4-9-23-24/h4-10,12H,11,13H2,1-3H3 |
| InChIKey | IIDDLDPTMDVYSV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|