C25H28ClN3O3 — CID 146614284
3-chloro-4-methoxy-2-[[methyl(oxolan-2-ylmethyl)amino]methyl]-5-[(4-pyrazol-1-ylphenyl)methyl]benzaldehyde (PubChem CID 146614284) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is 3-chloro-4-methoxy-2-[[methyl(oxolan-2-ylmethyl)amino]methyl]-5-[(4-pyrazol-1-ylphenyl)methyl]benzaldehyde.
| Compound Name | 3-chloro-4-methoxy-2-[[methyl(oxolan-2-ylmethyl)amino]methyl]-5-[(4-pyrazol-1-ylphenyl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 146614284 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 3-chloro-4-methoxy-2-[[methyl(oxolan-2-ylmethyl)amino]methyl]-5-[(4-pyrazol-1-ylphenyl)methyl]benzaldehyde |
| SMILES | COc1c(Cc2ccc(-n3cccn3)cc2)cc(C=O)c(CN(C)CC2CCCO2)c1Cl |
| InChI | InChI=1S/C25H28ClN3O3/c1-28(15-22-5-3-12-32-22)16-23-20(17-30)14-19(25(31-2)24(23)26)13-18-6-8-21(9-7-18)29-11-4-10-27-29/h4,6-11,14,17,22H,3,5,12-13,15-16H2,1-2H3 |
| InChIKey | SMZITHXHJLHPQA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|