C15H12ClN3O — CID 125491841
6-chloro-4-[(4-pyrazol-1-ylphenyl)methyl]pyridin-3-ol (PubChem CID 125491841) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 6-chloro-4-[(4-pyrazol-1-ylphenyl)methyl]pyridin-3-ol.
| Compound Name | 6-chloro-4-[(4-pyrazol-1-ylphenyl)methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 125491841 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 6-chloro-4-[(4-pyrazol-1-ylphenyl)methyl]pyridin-3-ol |
| SMILES | Oc1cnc(Cl)cc1Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C15H12ClN3O/c16-15-9-12(14(20)10-17-15)8-11-2-4-13(5-3-11)19-7-1-6-18-19/h1-7,9-10,20H,8H2 |
| InChIKey | MZCCDCGKLIMODL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|