C15H17N7 — CID 145270329
6-hydrazinyl-4-[(4-pyrazol-1-ylphenyl)methyl]pyridine-2,5-diamine (PubChem CID 145270329) has the molecular formula C15H17N7 and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-hydrazinyl-4-[(4-pyrazol-1-ylphenyl)methyl]pyridine-2,5-diamine.
| Compound Name | 6-hydrazinyl-4-[(4-pyrazol-1-ylphenyl)methyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 145270329 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 6-hydrazinyl-4-[(4-pyrazol-1-ylphenyl)methyl]pyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(Cc2ccc(-n3cccn3)cc2)c1N |
| InChI | InChI=1S/C15H17N7/c16-13-9-11(14(17)15(20-13)21-18)8-10-2-4-12(5-3-10)22-7-1-6-19-22/h1-7,9H,8,17-18H2,(H3,16,20,21) |
| InChIKey | VMUOPYCETNFITQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|