C18H18N8 — CID 145270165
6-hydrazinyl-4-[(1-isoquinolin-4-ylpyrazol-4-yl)methyl]pyridine-2,5-diamine (PubChem CID 145270165) has the molecular formula C18H18N8 and a molecular weight of 346.40 g/mol. Its IUPAC name is 6-hydrazinyl-4-[(1-isoquinolin-4-ylpyrazol-4-yl)methyl]pyridine-2,5-diamine.
| Compound Name | 6-hydrazinyl-4-[(1-isoquinolin-4-ylpyrazol-4-yl)methyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 145270165 |
| Molecular Formula | C18H18N8 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 6-hydrazinyl-4-[(1-isoquinolin-4-ylpyrazol-4-yl)methyl]pyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(Cc2cnn(-c3cncc4ccccc34)c2)c1N |
| InChI | InChI=1S/C18H18N8/c19-16-6-13(17(20)18(24-16)25-21)5-11-7-23-26(10-11)15-9-22-8-12-3-1-2-4-14(12)15/h1-4,6-10H,5,20-21H2,(H3,19,24,25) |
| InChIKey | WPONEIDVLWQMGB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|