C12H14FN5 — CID 130451115
4-[(3-fluorophenyl)methyl]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 130451115) has the molecular formula C12H14FN5 and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[(3-fluorophenyl)methyl]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 130451115 |
| Molecular Formula | C12H14FN5 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(Cc2cccc(F)c2)c1N |
| InChI | InChI=1S/C12H14FN5/c13-9-3-1-2-7(5-9)4-8-6-10(14)17-12(18-16)11(8)15/h1-3,5-6H,4,15-16H2,(H3,14,17,18) |
| InChIKey | KFNCIIIBHSFNGA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|