C19H20FN5O — CID 126678926
4-[[5-(3-fluorophenyl)-2-methylphenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126678926) has the molecular formula C19H20FN5O and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-[[5-(3-fluorophenyl)-2-methylphenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[[5-(3-fluorophenyl)-2-methylphenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126678926 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 4-[[5-(3-fluorophenyl)-2-methylphenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | Cc1ccc(-c2cccc(F)c2)cc1COc1cc(N)nc(NN)c1N |
| InChI | InChI=1S/C19H20FN5O/c1-11-5-6-13(12-3-2-4-15(20)8-12)7-14(11)10-26-16-9-17(21)24-19(25-23)18(16)22/h2-9H,10,22-23H2,1H3,(H3,21,24,25) |
| InChIKey | SNMSUNVCQRSAFX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|