C12H13F6N5OS — CID 126680585
4-[[2-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126680585) has the molecular formula C12H13F6N5OS and a molecular weight of 389.33 g/mol. Its IUPAC name is 4-[[2-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[[2-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126680585 |
| Molecular Formula | C12H13F6N5OS |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-[[2-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(OCc2cc(S(F)(F)(F)(F)F)ccc2F)c1N |
| InChI | InChI=1S/C12H13F6N5OS/c13-8-2-1-7(25(14,15,16,17)18)3-6(8)5-24-9-4-10(19)22-12(23-21)11(9)20/h1-4H,5,20-21H2,(H3,19,22,23) |
| InChIKey | MAPYQVZHWGHULG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|