C18H18FN5O — CID 126678935
4-[[3-(2-fluorophenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126678935) has the molecular formula C18H18FN5O and a molecular weight of 339.37 g/mol. Its IUPAC name is 4-[[3-(2-fluorophenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[[3-(2-fluorophenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126678935 |
| Molecular Formula | C18H18FN5O |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-[[3-(2-fluorophenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(OCc2cccc(-c3ccccc3F)c2)c1N |
| InChI | InChI=1S/C18H18FN5O/c19-14-7-2-1-6-13(14)12-5-3-4-11(8-12)10-25-15-9-16(20)23-18(24-22)17(15)21/h1-9H,10,21-22H2,(H3,20,23,24) |
| InChIKey | ISXIJHLZZUVBGM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|