C18H14ClN5O — CID 126648893
7-[[3-(2-chlorophenyl)phenyl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine (PubChem CID 126648893) has the molecular formula C18H14ClN5O and a molecular weight of 351.80 g/mol. Its IUPAC name is 7-[[3-(2-chlorophenyl)phenyl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine.
| Compound Name | 7-[[3-(2-chlorophenyl)phenyl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 126648893 |
| Molecular Formula | C18H14ClN5O |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 7-[[3-(2-chlorophenyl)phenyl]methoxy]-2H-triazolo[4,5-b]pyridin-5-amine |
| SMILES | Nc1cc(OCc2cccc(-c3ccccc3Cl)c2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C18H14ClN5O/c19-14-7-2-1-6-13(14)12-5-3-4-11(8-12)10-25-15-9-16(20)21-18-17(15)22-24-23-18/h1-9H,10H2,(H3,20,21,22,23,24) |
| InChIKey | PDVXFAFDZRLJIK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |