C13H15F2N5O2 — CID 126678797
4-[[4-(difluoromethoxy)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126678797) has the molecular formula C13H15F2N5O2 and a molecular weight of 311.29 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[[4-(difluoromethoxy)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126678797 |
| Molecular Formula | C13H15F2N5O2 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-[[4-(difluoromethoxy)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(OCc2ccc(OC(F)F)cc2)c1N |
| InChI | InChI=1S/C13H15F2N5O2/c14-13(15)22-8-3-1-7(2-4-8)6-21-9-5-10(16)19-12(20-18)11(9)17/h1-5,13H,6,17-18H2,(H3,16,19,20) |
| InChIKey | GVDCOYMALUJNCJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|