C19H19F2N5O2 — CID 126680575
4-[[2,6-difluoro-3-(2-methoxyphenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126680575) has the molecular formula C19H19F2N5O2 and a molecular weight of 387.39 g/mol. Its IUPAC name is 4-[[2,6-difluoro-3-(2-methoxyphenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[[2,6-difluoro-3-(2-methoxyphenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126680575 |
| Molecular Formula | C19H19F2N5O2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-[[2,6-difluoro-3-(2-methoxyphenyl)phenyl]methoxy]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | COc1ccccc1-c1ccc(F)c(COc2cc(N)nc(NN)c2N)c1F |
| InChI | InChI=1S/C19H19F2N5O2/c1-27-14-5-3-2-4-10(14)11-6-7-13(20)12(17(11)21)9-28-15-8-16(22)25-19(26-24)18(15)23/h2-8H,9,23-24H2,1H3,(H3,22,25,26) |
| InChIKey | PZSXZBCDQGNWGS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|