About methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate
methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate (PubChem CID 126680550) has the molecular formula C14H17N5O3
and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate |
| PubChem CID | 126680550 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COc2cc(N)nc(NN)c2N)c1 |
| InChI | InChI=1S/C14H17N5O3/c1-21-14(20)9-4-2-3-8(5-9)7-22-10-6-11(15)18-13(19-17)12(10)16/h2-6H,7,16-17H2,1H3,(H3,15,18,19) |
| InChIKey | DNJMCHKJZMQCRB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate?
The IUPAC name of methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate (CID 126680550) is methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate.
What is the SMILES notation for methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate?
The canonical SMILES for methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate is COC(=O)c1cccc(COc2cc(N)nc(NN)c2N)c1.
What is the InChIKey of methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate?
The InChIKey is DNJMCHKJZMQCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O3/c1-21-14(20)9-4-2-3-8(5-9)7-22-10-6-11(15)18-13(19-17)12(10)16/h2-6H,7,16-17H2,1H3,(H3,15,18,19).
What are the key properties of methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate?
methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate has a molecular weight of 303.32 g/mol, XLogP of 0.90, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate is sourced from PubChem (CID 126680550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).