C14H16ClN5O3 — CID 126680569
methyl 3-chloro-4-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate (PubChem CID 126680569) has the molecular formula C14H16ClN5O3 and a molecular weight of 337.77 g/mol. Its IUPAC name is methyl 3-chloro-4-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate.
| Compound Name | methyl 3-chloro-4-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 126680569 |
| Molecular Formula | C14H16ClN5O3 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | methyl 3-chloro-4-[(3,6-diamino-2-hydrazinyl-4-pyridinyl)oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2cc(N)nc(NN)c2N)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClN5O3/c1-22-14(21)7-2-3-8(9(15)4-7)6-23-10-5-11(16)19-13(20-18)12(10)17/h2-5H,6,17-18H2,1H3,(H3,16,19,20) |
| InChIKey | QXXOOADVABUNSP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|