methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate

C15H11BrCl2O3 — CID 102765334

IUPACmethyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate
SMILESCOC(=O)c1ccc(COc2ccc(Cl)cc2Cl)c(Br)c1
InChIInChI=1S/C15H11BrCl2O3/c1-20-15(19)9-2-3-10(12(16)6-9)8-21-14-5-4-11(17)7-13(14)18/h2-7H,8H2,1H3
InChIKeyHXBXWVSFNDNQIA-UHFFFAOYSA-N
MW390.06 g/mol
LogP5.12
Rot. Bonds4

About methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate

methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate (PubChem CID 102765334) has the molecular formula C15H11BrCl2O3 and a molecular weight of 390.06 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate
PubChem CID102765334
Molecular FormulaC15H11BrCl2O3
Molecular Weight390.06 g/mol
Exact Mass387.93
IUPAC Namemethyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate
SMILESCOC(=O)c1ccc(COc2ccc(Cl)cc2Cl)c(Br)c1
InChIInChI=1S/C15H11BrCl2O3/c1-20-15(19)9-2-3-10(12(16)6-9)8-21-14-5-4-11(17)7-13(14)18/h2-7H,8H2,1H3
InChIKeyHXBXWVSFNDNQIA-UHFFFAOYSA-N
XLogP5.12
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500390.06
LogP ≤ 55.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate?
The IUPAC name of methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate (CID 102765334) is methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate.
What is the SMILES notation for methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate?
The canonical SMILES for methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate is COC(=O)c1ccc(COc2ccc(Cl)cc2Cl)c(Br)c1.
What is the InChIKey of methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate?
The InChIKey is HXBXWVSFNDNQIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrCl2O3/c1-20-15(19)9-2-3-10(12(16)6-9)8-21-14-5-4-11(17)7-13(14)18/h2-7H,8H2,1H3.
What are the key properties of methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate?
methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate has a molecular weight of 390.06 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-[(2,4-dichlorophenoxy)methyl]benzoate is sourced from PubChem (CID 102765334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).