C15H11BrF2O3 — CID 102765577
methyl 3-bromo-4-[(2,6-difluorophenoxy)methyl]benzoate (PubChem CID 102765577) has the molecular formula C15H11BrF2O3 and a molecular weight of 357.15 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2,6-difluorophenoxy)methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[(2,6-difluorophenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 102765577 |
| Molecular Formula | C15H11BrF2O3 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | methyl 3-bromo-4-[(2,6-difluorophenoxy)methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2c(F)cccc2F)c(Br)c1 |
| InChI | InChI=1S/C15H11BrF2O3/c1-20-15(19)9-5-6-10(11(16)7-9)8-21-14-12(17)3-2-4-13(14)18/h2-7H,8H2,1H3 |
| InChIKey | AVTNEZWLPXTPPE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |