C13H8BrF3O — CID 113220141
2-bromo-1-[(2,6-difluorophenoxy)methyl]-4-fluorobenzene (PubChem CID 113220141) has the molecular formula C13H8BrF3O and a molecular weight of 317.10 g/mol. Its IUPAC name is 2-bromo-1-[(2,6-difluorophenoxy)methyl]-4-fluorobenzene.
| Compound Name | 2-bromo-1-[(2,6-difluorophenoxy)methyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 113220141 |
| Molecular Formula | C13H8BrF3O |
| Molecular Weight | 317.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 2-bromo-1-[(2,6-difluorophenoxy)methyl]-4-fluorobenzene |
| SMILES | Fc1ccc(COc2c(F)cccc2F)c(Br)c1 |
| InChI | InChI=1S/C13H8BrF3O/c14-10-6-9(15)5-4-8(10)7-18-13-11(16)2-1-3-12(13)17/h1-6H,7H2 |
| InChIKey | OJLHYPSLGCCJLD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.10 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |