C13H16BrN5O2 — CID 126678860
4-[(5-bromo-2-methoxyphenyl)methoxy]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126678860) has the molecular formula C13H16BrN5O2 and a molecular weight of 354.21 g/mol. Its IUPAC name is 4-[(5-bromo-2-methoxyphenyl)methoxy]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[(5-bromo-2-methoxyphenyl)methoxy]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126678860 |
| Molecular Formula | C13H16BrN5O2 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-[(5-bromo-2-methoxyphenyl)methoxy]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | COc1ccc(Br)cc1COc1cc(N)nc(NN)c1N |
| InChI | InChI=1S/C13H16BrN5O2/c1-20-9-3-2-8(14)4-7(9)6-21-10-5-11(15)18-13(19-17)12(10)16/h2-5H,6,16-17H2,1H3,(H3,15,18,19) |
| InChIKey | FICGMTCBHQSCDF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|