C16H18N6O — CID 126678943
4-[[3-(2-methylpyrazol-3-yl)phenyl]methoxy]pyridine-2,3,6-triamine (PubChem CID 126678943) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-[[3-(2-methylpyrazol-3-yl)phenyl]methoxy]pyridine-2,3,6-triamine.
| Compound Name | 4-[[3-(2-methylpyrazol-3-yl)phenyl]methoxy]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 126678943 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-[[3-(2-methylpyrazol-3-yl)phenyl]methoxy]pyridine-2,3,6-triamine |
| SMILES | Cn1nccc1-c1cccc(COc2cc(N)nc(N)c2N)c1 |
| InChI | InChI=1S/C16H18N6O/c1-22-12(5-6-20-22)11-4-2-3-10(7-11)9-23-13-8-14(17)21-16(19)15(13)18/h2-8H,9,18H2,1H3,(H4,17,19,21) |
| InChIKey | QCBMOUJWUQTLNR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |