C17H23N5O — CID 145039447
4-[[2-(butylideneamino)-3-methylphenyl]methoxy]pyridine-2,3,6-triamine (PubChem CID 145039447) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-[[2-(butylideneamino)-3-methylphenyl]methoxy]pyridine-2,3,6-triamine.
| Compound Name | 4-[[2-(butylideneamino)-3-methylphenyl]methoxy]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 145039447 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 4-[[2-(butylideneamino)-3-methylphenyl]methoxy]pyridine-2,3,6-triamine |
| SMILES | CCC/C=N/c1c(C)cccc1COc1cc(N)nc(N)c1N |
| InChI | InChI=1S/C17H23N5O/c1-3-4-8-21-16-11(2)6-5-7-12(16)10-23-13-9-14(18)22-17(20)15(13)19/h5-9H,3-4,10,19H2,1-2H3,(H4,18,20,22)/b21-8+ |
| InChIKey | ZZCXVLLHIGSCIG-ODCIPOBUSA-N |
| XLogP | 3.22 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|