C5H8BrN5 — CID 126676407
4-bromo-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126676407) has the molecular formula C5H8BrN5 and a molecular weight of 218.06 g/mol. Its IUPAC name is 4-bromo-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-bromo-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126676407 |
| Molecular Formula | C5H8BrN5 |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 4-bromo-6-hydrazinylpyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(Br)c1N |
| InChI | InChI=1S/C5H8BrN5/c6-2-1-3(7)10-5(11-9)4(2)8/h1H,8-9H2,(H3,7,10,11) |
| InChIKey | JLZJHKZOFZZKNC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|